C31H41Cl3N4O4 — CID 23641438
methyl (2S,4S)-4-[[(2R)-3-(4-chlorophenyl)-2-[[(3R)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]propanoyl]amino]-1-cyclohexylpyrrolidine-2-carboxylate;dihydrochloride (PubChem CID 23641438) has the molecular formula C31H41Cl3N4O4 and a molecular weight of 640.05 g/mol. Its IUPAC name is methyl (2S,4S)-4-[[(2R)-3-(4-chlorophenyl)-2-[[(3R)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]propanoyl]amino]-1-cyclohexylpyrrolidine-2-carboxylate;dihydrochloride.
| Compound Name | methyl (2S,4S)-4-[[(2R)-3-(4-chlorophenyl)-2-[[(3R)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]propanoyl]amino]-1-cyclohexylpyrrolidine-2-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 23641438 |
| Molecular Formula | C31H41Cl3N4O4 |
| Molecular Weight | 640.05 g/mol |
| Exact Mass | 638.22 |
| IUPAC Name | methyl (2S,4S)-4-[[(2R)-3-(4-chlorophenyl)-2-[[(3R)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]propanoyl]amino]-1-cyclohexylpyrrolidine-2-carboxylate;dihydrochloride |
| SMILES | COC(=O)[C@@H]1C[C@H](NC(=O)[C@@H](Cc2ccc(Cl)cc2)NC(=O)[C@H]2Cc3ccccc3CN2)CN1C1CCCCC1.Cl.Cl |
| InChI | InChI=1S/C31H39ClN4O4.2ClH/c1-40-31(39)28-17-24(19-36(28)25-9-3-2-4-10-25)34-30(38)27(15-20-11-13-23(32)14-12-20)35-29(37)26-16-21-7-5-6-8-22(21)18-33-26;;/h5-8,11-14,24-28,33H,2-4,9-10,15-19H2,1H3,(H,34,38)(H,35,37);2*1H/t24-,26+,27+,28-;;/m0../s1 |
| InChIKey | FXTOXCVHMDKMMM-VGJBWFEGSA-N |
| XLogP | 3.99 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.05 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |