C35H46ClN5O3 — CID 23641441
(3R)-N-[(2R)-3-(4-chlorophenyl)-1-[[(3S,5S)-1-cyclohexyl-5-(piperidine-1-carbonyl)pyrrolidin-3-yl]amino]-1-oxopropan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 23641441) has the molecular formula C35H46ClN5O3 and a molecular weight of 620.24 g/mol. Its IUPAC name is (3R)-N-[(2R)-3-(4-chlorophenyl)-1-[[(3S,5S)-1-cyclohexyl-5-(piperidine-1-carbonyl)pyrrolidin-3-yl]amino]-1-oxopropan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | (3R)-N-[(2R)-3-(4-chlorophenyl)-1-[[(3S,5S)-1-cyclohexyl-5-(piperidine-1-carbonyl)pyrrolidin-3-yl]amino]-1-oxopropan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 23641441 |
| Molecular Formula | C35H46ClN5O3 |
| Molecular Weight | 620.24 g/mol |
| Exact Mass | 619.33 |
| IUPAC Name | (3R)-N-[(2R)-3-(4-chlorophenyl)-1-[[(3S,5S)-1-cyclohexyl-5-(piperidine-1-carbonyl)pyrrolidin-3-yl]amino]-1-oxopropan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | O=C(N[C@H](Cc1ccc(Cl)cc1)C(=O)N[C@H]1C[C@@H](C(=O)N2CCCCC2)N(C2CCCCC2)C1)[C@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C35H46ClN5O3/c36-27-15-13-24(14-16-27)19-31(39-33(42)30-20-25-9-5-6-10-26(25)22-37-30)34(43)38-28-21-32(35(44)40-17-7-2-8-18-40)41(23-28)29-11-3-1-4-12-29/h5-6,9-10,13-16,28-32,37H,1-4,7-8,11-12,17-23H2,(H,38,43)(H,39,42)/t28-,30+,31+,32-/m0/s1 |
| InChIKey | NCEFFERAMKZDES-NELGLHRDSA-N |
| XLogP | 3.99 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.24 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |