C19H25F3N2O5S — CID 23642055
2-methoxyethyl 4-[cyclopropyl-[3-(trifluoromethyl)phenyl]sulfonylamino]piperidine-1-carboxylate (PubChem CID 23642055) has the molecular formula C19H25F3N2O5S and a molecular weight of 450.48 g/mol. Its IUPAC name is 2-methoxyethyl 4-[cyclopropyl-[3-(trifluoromethyl)phenyl]sulfonylamino]piperidine-1-carboxylate.
| Compound Name | 2-methoxyethyl 4-[cyclopropyl-[3-(trifluoromethyl)phenyl]sulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 23642055 |
| Molecular Formula | C19H25F3N2O5S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 2-methoxyethyl 4-[cyclopropyl-[3-(trifluoromethyl)phenyl]sulfonylamino]piperidine-1-carboxylate |
| SMILES | COCCOC(=O)N1CCC(N(C2CC2)S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H25F3N2O5S/c1-28-11-12-29-18(25)23-9-7-16(8-10-23)24(15-5-6-15)30(26,27)17-4-2-3-14(13-17)19(20,21)22/h2-4,13,15-16H,5-12H2,1H3 |
| InChIKey | QIXXQCCRESCKNN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|