C18H23NO4 — CID 23642199
4-[3-(cyclohexylmethylcarbamoyl)phenyl]-4-oxobutanoic acid (PubChem CID 23642199) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-[3-(cyclohexylmethylcarbamoyl)phenyl]-4-oxobutanoic acid.
| Compound Name | 4-[3-(cyclohexylmethylcarbamoyl)phenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 23642199 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 4-[3-(cyclohexylmethylcarbamoyl)phenyl]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)c1cccc(C(=O)NCC2CCCCC2)c1 |
| InChI | InChI=1S/C18H23NO4/c20-16(9-10-17(21)22)14-7-4-8-15(11-14)18(23)19-12-13-5-2-1-3-6-13/h4,7-8,11,13H,1-3,5-6,9-10,12H2,(H,19,23)(H,21,22) |
| InChIKey | AVZOKZJPKBZACX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |