C20H27NO4 — CID 46794502
[1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 4-oxo-4-phenylbutanoate (PubChem CID 46794502) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is [1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 4-oxo-4-phenylbutanoate.
| Compound Name | [1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 4-oxo-4-phenylbutanoate |
|---|---|
| PubChem CID | 46794502 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | [1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 4-oxo-4-phenylbutanoate |
| SMILES | CC(OC(=O)CCC(=O)c1ccccc1)C(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C20H27NO4/c1-15(20(24)21-14-16-8-4-2-5-9-16)25-19(23)13-12-18(22)17-10-6-3-7-11-17/h3,6-7,10-11,15-16H,2,4-5,8-9,12-14H2,1H3,(H,21,24) |
| InChIKey | OSGQQJOVWDSLBE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |