C20H20BrNO4 — CID 55306428
[1-(benzylamino)-1-oxopropan-2-yl] 4-(4-bromophenyl)-4-oxobutanoate (PubChem CID 55306428) has the molecular formula C20H20BrNO4 and a molecular weight of 418.29 g/mol. Its IUPAC name is [1-(benzylamino)-1-oxopropan-2-yl] 4-(4-bromophenyl)-4-oxobutanoate.
| Compound Name | [1-(benzylamino)-1-oxopropan-2-yl] 4-(4-bromophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 55306428 |
| Molecular Formula | C20H20BrNO4 |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | [1-(benzylamino)-1-oxopropan-2-yl] 4-(4-bromophenyl)-4-oxobutanoate |
| SMILES | CC(OC(=O)CCC(=O)c1ccc(Br)cc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H20BrNO4/c1-14(20(25)22-13-15-5-3-2-4-6-15)26-19(24)12-11-18(23)16-7-9-17(21)10-8-16/h2-10,14H,11-13H2,1H3,(H,22,25) |
| InChIKey | GIFRFEXCGVBLPP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |