C13H20NO4PS — CID 23643629
3-[(diethoxyphosphinothioylamino)-(furan-2-yl)methyl]but-3-en-2-one (PubChem CID 23643629) has the molecular formula C13H20NO4PS and a molecular weight of 317.35 g/mol. Its IUPAC name is 3-[(diethoxyphosphinothioylamino)-(furan-2-yl)methyl]but-3-en-2-one.
| Compound Name | 3-[(diethoxyphosphinothioylamino)-(furan-2-yl)methyl]but-3-en-2-one |
|---|---|
| PubChem CID | 23643629 |
| Molecular Formula | C13H20NO4PS |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 3-[(diethoxyphosphinothioylamino)-(furan-2-yl)methyl]but-3-en-2-one |
| SMILES | C=C(C(C)=O)C(NP(=S)(OCC)OCC)c1ccco1 |
| InChI | InChI=1S/C13H20NO4PS/c1-5-17-19(20,18-6-2)14-13(10(3)11(4)15)12-8-7-9-16-12/h7-9,13H,3,5-6H2,1-2,4H3,(H,14,20) |
| InChIKey | ILSDSXZLSXOWFH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|