C21H43NO7P+ — CID 23644142
2-[3,4-di(hexanoyloxy)butyl-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 23644142) has the molecular formula C21H43NO7P+ and a molecular weight of 452.55 g/mol. Its IUPAC name is 2-[3,4-di(hexanoyloxy)butyl-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[3,4-di(hexanoyloxy)butyl-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 23644142 |
| Molecular Formula | C21H43NO7P+ |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 2-[3,4-di(hexanoyloxy)butyl-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCC(=O)OCC(CCP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCC |
| InChI | InChI=1S/C21H42NO7P/c1-6-8-10-12-20(23)27-18-19(29-21(24)13-11-9-7-2)14-17-30(25,26)28-16-15-22(3,4)5/h19H,6-18H2,1-5H3/p+1 |
| InChIKey | BRTDPJPTKQNAET-UHFFFAOYSA-O |
| XLogP | 3.90 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|