C14H11ClF9NO4S — CID 23645757
2-[(2-chlorophenyl)methyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propanoic acid (PubChem CID 23645757) has the molecular formula C14H11ClF9NO4S and a molecular weight of 495.75 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propanoic acid.
| Compound Name | 2-[(2-chlorophenyl)methyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 23645757 |
| Molecular Formula | C14H11ClF9NO4S |
| Molecular Weight | 495.75 g/mol |
| Exact Mass | 495.00 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propanoic acid |
| SMILES | CC(C(=O)O)N(Cc1ccccc1Cl)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H11ClF9NO4S/c1-7(10(26)27)25(6-8-4-2-3-5-9(8)15)30(28,29)14(23,24)12(18,19)11(16,17)13(20,21)22/h2-5,7H,6H2,1H3,(H,26,27) |
| InChIKey | FCSMTOMUTXJZTE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.75 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|