C14H12ClF9N2O4S — CID 23645537
2-[(2-chlorophenyl)methyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-N-hydroxypropanamide (PubChem CID 23645537) has the molecular formula C14H12ClF9N2O4S and a molecular weight of 510.76 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-N-hydroxypropanamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 23645537 |
| Molecular Formula | C14H12ClF9N2O4S |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.01 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-N-hydroxypropanamide |
| SMILES | CC(C(=O)NO)N(Cc1ccccc1Cl)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12ClF9N2O4S/c1-7(10(27)25-28)26(6-8-4-2-3-5-9(8)15)31(29,30)14(23,24)12(18,19)11(16,17)13(20,21)22/h2-5,7,28H,6H2,1H3,(H,25,27) |
| InChIKey | DUCBSHDQTBWWLC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|