C17H17ClFN3O5S — CID 23645830
2-[(2-chlorophenyl)methyl-[(4-fluorophenyl)sulfonylcarbamoyl]amino]-N-hydroxypropanamide (PubChem CID 23645830) has the molecular formula C17H17ClFN3O5S and a molecular weight of 429.86 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-[(4-fluorophenyl)sulfonylcarbamoyl]amino]-N-hydroxypropanamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-[(4-fluorophenyl)sulfonylcarbamoyl]amino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 23645830 |
| Molecular Formula | C17H17ClFN3O5S |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-[(4-fluorophenyl)sulfonylcarbamoyl]amino]-N-hydroxypropanamide |
| SMILES | CC(C(=O)NO)N(Cc1ccccc1Cl)C(=O)NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17ClFN3O5S/c1-11(16(23)20-25)22(10-12-4-2-3-5-15(12)18)17(24)21-28(26,27)14-8-6-13(19)7-9-14/h2-9,11,25H,10H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | HJOPVZQTJLDXHZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|