C18H12ClF17N2O4S — CID 23645791
2-[(2-chlorophenyl)methyl-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)amino]-N-hydroxypropanamide (PubChem CID 23645791) has the molecular formula C18H12ClF17N2O4S and a molecular weight of 710.79 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)amino]-N-hydroxypropanamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)amino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 23645791 |
| Molecular Formula | C18H12ClF17N2O4S |
| Molecular Weight | 710.79 g/mol |
| Exact Mass | 709.99 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)amino]-N-hydroxypropanamide |
| SMILES | CC(C(=O)NO)N(Cc1ccccc1Cl)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H12ClF17N2O4S/c1-7(10(39)37-40)38(6-8-4-2-3-5-9(8)19)43(41,42)18(35,36)16(30,31)14(26,27)12(22,23)11(20,21)13(24,25)15(28,29)17(32,33)34/h2-5,7,40H,6H2,1H3,(H,37,39) |
| InChIKey | RAKDLXHATYBBPG-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.79 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|