C19H23FN6O2 — CID 23646063
5-[(E)-3-(dimethylamino)propoxyiminomethyl]-6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]pyrimidin-4-amine (PubChem CID 23646063) has the molecular formula C19H23FN6O2 and a molecular weight of 386.43 g/mol. Its IUPAC name is 5-[(E)-3-(dimethylamino)propoxyiminomethyl]-6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]pyrimidin-4-amine.
| Compound Name | 5-[(E)-3-(dimethylamino)propoxyiminomethyl]-6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 23646063 |
| Molecular Formula | C19H23FN6O2 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 5-[(E)-3-(dimethylamino)propoxyiminomethyl]-6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]pyrimidin-4-amine |
| SMILES | Cc1cc2c(F)c(Oc3ncnc(N)c3/C=N/OCCCN(C)C)ccc2[nH]1 |
| InChI | InChI=1S/C19H23FN6O2/c1-12-9-13-15(25-12)5-6-16(17(13)20)28-19-14(18(21)22-11-23-19)10-24-27-8-4-7-26(2)3/h5-6,9-11,25H,4,7-8H2,1-3H3,(H2,21,22,23)/b24-10+ |
| InChIKey | BKDLAIFMKAORSS-YSURURNPSA-N |
| XLogP | 3.08 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|