C17H18FN5O3 — CID 23646068
3-[(E)-[4-amino-6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]pyrimidin-5-yl]methylideneamino]oxypropan-1-ol (PubChem CID 23646068) has the molecular formula C17H18FN5O3 and a molecular weight of 359.36 g/mol. Its IUPAC name is 3-[(E)-[4-amino-6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]pyrimidin-5-yl]methylideneamino]oxypropan-1-ol.
| Compound Name | 3-[(E)-[4-amino-6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]pyrimidin-5-yl]methylideneamino]oxypropan-1-ol |
|---|---|
| PubChem CID | 23646068 |
| Molecular Formula | C17H18FN5O3 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 3-[(E)-[4-amino-6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]pyrimidin-5-yl]methylideneamino]oxypropan-1-ol |
| SMILES | Cc1cc2c(F)c(Oc3ncnc(N)c3/C=N/OCCCO)ccc2[nH]1 |
| InChI | InChI=1S/C17H18FN5O3/c1-10-7-11-13(23-10)3-4-14(15(11)18)26-17-12(16(19)20-9-21-17)8-22-25-6-2-5-24/h3-4,7-9,23-24H,2,5-6H2,1H3,(H2,19,20,21)/b22-8+ |
| InChIKey | PJLXIULWTYKMBC-GZIVZEMBSA-N |
| XLogP | 2.51 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|