C25H16F4N8O3 — CID 23646198
1-(3-carbamimidoylphenyl)-N-[2-fluoro-4-(5-nitrobenzimidazol-1-yl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 23646198) has the molecular formula C25H16F4N8O3 and a molecular weight of 552.45 g/mol. Its IUPAC name is 1-(3-carbamimidoylphenyl)-N-[2-fluoro-4-(5-nitrobenzimidazol-1-yl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 1-(3-carbamimidoylphenyl)-N-[2-fluoro-4-(5-nitrobenzimidazol-1-yl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 23646198 |
| Molecular Formula | C25H16F4N8O3 |
| Molecular Weight | 552.45 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 1-(3-carbamimidoylphenyl)-N-[2-fluoro-4-(5-nitrobenzimidazol-1-yl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(-n2nc(C(F)(F)F)cc2C(=O)Nc2ccc(-n3cnc4cc([N+](=O)[O-])ccc43)cc2F)c1 |
| InChI | InChI=1S/C25H16F4N8O3/c26-17-9-14(35-12-32-19-10-16(37(39)40)5-7-20(19)35)4-6-18(17)33-24(38)21-11-22(25(27,28)29)34-36(21)15-3-1-2-13(8-15)23(30)31/h1-12H,(H3,30,31)(H,33,38) |
| InChIKey | WUSRGHHERUYXLJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 157.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|