C21H22N4O — CID 23647075
1,3-diethyl-5-[2-(3-methylphenyl)pyrazol-3-yl]benzimidazol-2-one (PubChem CID 23647075) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is 1,3-diethyl-5-[2-(3-methylphenyl)pyrazol-3-yl]benzimidazol-2-one.
| Compound Name | 1,3-diethyl-5-[2-(3-methylphenyl)pyrazol-3-yl]benzimidazol-2-one |
|---|---|
| PubChem CID | 23647075 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1,3-diethyl-5-[2-(3-methylphenyl)pyrazol-3-yl]benzimidazol-2-one |
| SMILES | CCn1c(=O)n(CC)c2cc(-c3ccnn3-c3cccc(C)c3)ccc21 |
| InChI | InChI=1S/C21H22N4O/c1-4-23-19-10-9-16(14-20(19)24(5-2)21(23)26)18-11-12-22-25(18)17-8-6-7-15(3)13-17/h6-14H,4-5H2,1-3H3 |
| InChIKey | XHAOCYLGIWUQKQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 44.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |