C27H34N6O — CID 162654873
1-[[3-tert-butyl-1-(4-tert-butylphenyl)pyrazol-5-yl]methyl]-3-(1-methylindazol-4-yl)urea (PubChem CID 162654873) has the molecular formula C27H34N6O and a molecular weight of 458.61 g/mol. Its IUPAC name is 1-[[3-tert-butyl-1-(4-tert-butylphenyl)pyrazol-5-yl]methyl]-3-(1-methylindazol-4-yl)urea.
| Compound Name | 1-[[3-tert-butyl-1-(4-tert-butylphenyl)pyrazol-5-yl]methyl]-3-(1-methylindazol-4-yl)urea |
|---|---|
| PubChem CID | 162654873 |
| Molecular Formula | C27H34N6O |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 1-[[3-tert-butyl-1-(4-tert-butylphenyl)pyrazol-5-yl]methyl]-3-(1-methylindazol-4-yl)urea |
| SMILES | Cn1ncc2c(NC(=O)NCc3cc(C(C)(C)C)nn3-c3ccc(C(C)(C)C)cc3)cccc21 |
| InChI | InChI=1S/C27H34N6O/c1-26(2,3)18-11-13-19(14-12-18)33-20(15-24(31-33)27(4,5)6)16-28-25(34)30-22-9-8-10-23-21(22)17-29-32(23)7/h8-15,17H,16H2,1-7H3,(H2,28,30,34) |
| InChIKey | OBQJXDFUIIBWHC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 76.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |