C25H48N4O5 — CID 23647295
(2R,4S,5S)-5-[[(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]propanoyl]amino]-N-butyl-4-hydroxy-2,7-dimethyloctanamide (PubChem CID 23647295) has the molecular formula C25H48N4O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is (2R,4S,5S)-5-[[(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]propanoyl]amino]-N-butyl-4-hydroxy-2,7-dimethyloctanamide.
| Compound Name | (2R,4S,5S)-5-[[(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]propanoyl]amino]-N-butyl-4-hydroxy-2,7-dimethyloctanamide |
|---|---|
| PubChem CID | 23647295 |
| Molecular Formula | C25H48N4O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | (2R,4S,5S)-5-[[(2S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]propanoyl]amino]-N-butyl-4-hydroxy-2,7-dimethyloctanamide |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(C)=O |
| InChI | InChI=1S/C25H48N4O5/c1-9-10-11-26-23(32)17(6)14-22(31)20(12-15(2)3)29-24(33)18(7)27-25(34)21(13-16(4)5)28-19(8)30/h15-18,20-22,31H,9-14H2,1-8H3,(H,26,32)(H,27,34)(H,28,30)(H,29,33)/t17-,18+,20+,21+,22+/m1/s1 |
| InChIKey | YBUAWZQWIXYUFU-NQOGSSOHSA-N |
| XLogP | 1.88 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|