C9H12N2O6S — CID 23647353
2-amino-3-[1-(carboxymethyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid (PubChem CID 23647353) has the molecular formula C9H12N2O6S and a molecular weight of 276.27 g/mol. Its IUPAC name is 2-amino-3-[1-(carboxymethyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid.
| Compound Name | 2-amino-3-[1-(carboxymethyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 23647353 |
| Molecular Formula | C9H12N2O6S |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 2-amino-3-[1-(carboxymethyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
| SMILES | NC(CSC1CC(=O)N(CC(=O)O)C1=O)C(=O)O |
| InChI | InChI=1S/C9H12N2O6S/c10-4(9(16)17)3-18-5-1-6(12)11(8(5)15)2-7(13)14/h4-5H,1-3,10H2,(H,13,14)(H,16,17) |
| InChIKey | FMPVTVDFAHXWNO-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|