C9H15N2O4S+ — CID 90983919
(2R)-2-amino-3-(1-ethyl-2,5-dioxopyrrolidin-1-ium-1-yl)sulfanylpropanoic acid (PubChem CID 90983919) has the molecular formula C9H15N2O4S+ and a molecular weight of 247.30 g/mol. Its IUPAC name is (2R)-2-amino-3-(1-ethyl-2,5-dioxopyrrolidin-1-ium-1-yl)sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-(1-ethyl-2,5-dioxopyrrolidin-1-ium-1-yl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 90983919 |
| Molecular Formula | C9H15N2O4S+ |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | (2R)-2-amino-3-(1-ethyl-2,5-dioxopyrrolidin-1-ium-1-yl)sulfanylpropanoic acid |
| SMILES | CC[N+]1(SC[C@H](N)C(=O)O)C(=O)CCC1=O |
| InChI | InChI=1S/C9H14N2O4S/c1-2-11(7(12)3-4-8(11)13)16-5-6(10)9(14)15/h6H,2-5,10H2,1H3/p+1/t6-/m0/s1 |
| InChIKey | SENKRUCRUJUCEW-LURJTMIESA-O |
| XLogP | -0.27 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|