C19H18BrNO2S — CID 23647934
1-(4-bromothiophen-2-yl)-2-[(2-phenoxyphenyl)methylamino]ethanol (PubChem CID 23647934) has the molecular formula C19H18BrNO2S and a molecular weight of 404.33 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-2-[(2-phenoxyphenyl)methylamino]ethanol.
| Compound Name | 1-(4-bromothiophen-2-yl)-2-[(2-phenoxyphenyl)methylamino]ethanol |
|---|---|
| PubChem CID | 23647934 |
| Molecular Formula | C19H18BrNO2S |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-2-[(2-phenoxyphenyl)methylamino]ethanol |
| SMILES | OC(CNCc1ccccc1Oc1ccccc1)c1cc(Br)cs1 |
| InChI | InChI=1S/C19H18BrNO2S/c20-15-10-19(24-13-15)17(22)12-21-11-14-6-4-5-9-18(14)23-16-7-2-1-3-8-16/h1-10,13,17,21-22H,11-12H2 |
| InChIKey | JVMPJVROHTYUSG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |