C14H10ClF7N2O — CID 23648048
6-[(2-chloro-2,2-difluoroethyl)-(2,2-difluoroethyl)amino]-4-(trifluoromethyl)-1H-quinolin-2-one (PubChem CID 23648048) has the molecular formula C14H10ClF7N2O and a molecular weight of 390.69 g/mol. Its IUPAC name is 6-[(2-chloro-2,2-difluoroethyl)-(2,2-difluoroethyl)amino]-4-(trifluoromethyl)-1H-quinolin-2-one.
| Compound Name | 6-[(2-chloro-2,2-difluoroethyl)-(2,2-difluoroethyl)amino]-4-(trifluoromethyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 23648048 |
| Molecular Formula | C14H10ClF7N2O |
| Molecular Weight | 390.69 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 6-[(2-chloro-2,2-difluoroethyl)-(2,2-difluoroethyl)amino]-4-(trifluoromethyl)-1H-quinolin-2-one |
| SMILES | O=c1cc(C(F)(F)F)c2cc(N(CC(F)F)CC(F)(F)Cl)ccc2[nH]1 |
| InChI | InChI=1S/C14H10ClF7N2O/c15-13(18,19)6-24(5-11(16)17)7-1-2-10-8(3-7)9(14(20,21)22)4-12(25)23-10/h1-4,11H,5-6H2,(H,23,25) |
| InChIKey | GNGVFMOKCYNONK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.69 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|