C28H39BrN6O3 — CID 23648341
1-(5-bromopyrimidin-2-yl)-N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]piperidine-4-carboxamide (PubChem CID 23648341) has the molecular formula C28H39BrN6O3 and a molecular weight of 587.56 g/mol. Its IUPAC name is 1-(5-bromopyrimidin-2-yl)-N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-(5-bromopyrimidin-2-yl)-N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 23648341 |
| Molecular Formula | C28H39BrN6O3 |
| Molecular Weight | 587.56 g/mol |
| Exact Mass | 586.23 |
| IUPAC Name | 1-(5-bromopyrimidin-2-yl)-N-[(2S)-3-cyclohexyl-1-[2-(4-methoxyanilino)ethylamino]-1-oxopropan-2-yl]piperidine-4-carboxamide |
| SMILES | COc1ccc(NCCNC(=O)[C@H](CC2CCCCC2)NC(=O)C2CCN(c3ncc(Br)cn3)CC2)cc1 |
| InChI | InChI=1S/C28H39BrN6O3/c1-38-24-9-7-23(8-10-24)30-13-14-31-27(37)25(17-20-5-3-2-4-6-20)34-26(36)21-11-15-35(16-12-21)28-32-18-22(29)19-33-28/h7-10,18-21,25,30H,2-6,11-17H2,1H3,(H,31,37)(H,34,36)/t25-/m0/s1 |
| InChIKey | MCBHNRRDKDEYCE-VWLOTQADSA-N |
| XLogP | 4.15 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|