C23H22N6O2 — CID 3233475
8-(4-methoxyphenyl)-6-phenyl-2-piperazin-1-ylpteridin-7-one (PubChem CID 3233475) has the molecular formula C23H22N6O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 8-(4-methoxyphenyl)-6-phenyl-2-piperazin-1-ylpteridin-7-one.
| Compound Name | 8-(4-methoxyphenyl)-6-phenyl-2-piperazin-1-ylpteridin-7-one |
|---|---|
| PubChem CID | 3233475 |
| Molecular Formula | C23H22N6O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 8-(4-methoxyphenyl)-6-phenyl-2-piperazin-1-ylpteridin-7-one |
| SMILES | COc1ccc(-n2c(=O)c(-c3ccccc3)nc3cnc(N4CCNCC4)nc32)cc1 |
| InChI | InChI=1S/C23H22N6O2/c1-31-18-9-7-17(8-10-18)29-21-19(15-25-23(27-21)28-13-11-24-12-14-28)26-20(22(29)30)16-5-3-2-4-6-16/h2-10,15,24H,11-14H2,1H3 |
| InChIKey | DNQNHMBKMMGDBJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |