C22H22Cl2N2OS — CID 23648445
trans-(1R,2R)-5,5-dichloro-N-(cyanomethyl)-2-[2-(4-methylsulfanylphenyl)phenyl]cyclohexane-1-carboxamide (PubChem CID 23648445) has the molecular formula C22H22Cl2N2OS and a molecular weight of 433.40 g/mol. Its IUPAC name is trans-(1R,2R)-5,5-dichloro-N-(cyanomethyl)-2-[2-(4-methylsulfanylphenyl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | trans-(1R,2R)-5,5-dichloro-N-(cyanomethyl)-2-[2-(4-methylsulfanylphenyl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 23648445 |
| Molecular Formula | C22H22Cl2N2OS |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | trans-(1R,2R)-5,5-dichloro-N-(cyanomethyl)-2-[2-(4-methylsulfanylphenyl)phenyl]cyclohexane-1-carboxamide |
| SMILES | CSc1ccc(-c2ccccc2[C@@H]2CCC(Cl)(Cl)C[C@H]2C(=O)NCC#N)cc1 |
| InChI | InChI=1S/C22H22Cl2N2OS/c1-28-16-8-6-15(7-9-16)17-4-2-3-5-18(17)19-10-11-22(23,24)14-20(19)21(27)26-13-12-25/h2-9,19-20H,10-11,13-14H2,1H3,(H,26,27)/t19-,20+/m0/s1 |
| InChIKey | GLZDKRQTDOWMEO-VQTJNVASSA-N |
| XLogP | 5.77 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|