C22H23FN2OS — CID 23648447
(1R,2R,5R)-N-(cyanomethyl)-5-fluoro-2-[2-(4-methylsulfanylphenyl)phenyl]cyclohexane-1-carboxamide (PubChem CID 23648447) has the molecular formula C22H23FN2OS and a molecular weight of 382.50 g/mol. Its IUPAC name is (1R,2R,5R)-N-(cyanomethyl)-5-fluoro-2-[2-(4-methylsulfanylphenyl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | (1R,2R,5R)-N-(cyanomethyl)-5-fluoro-2-[2-(4-methylsulfanylphenyl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 23648447 |
| Molecular Formula | C22H23FN2OS |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (1R,2R,5R)-N-(cyanomethyl)-5-fluoro-2-[2-(4-methylsulfanylphenyl)phenyl]cyclohexane-1-carboxamide |
| SMILES | CSc1ccc(-c2ccccc2[C@@H]2CC[C@@H](F)C[C@H]2C(=O)NCC#N)cc1 |
| InChI | InChI=1S/C22H23FN2OS/c1-27-17-9-6-15(7-10-17)18-4-2-3-5-19(18)20-11-8-16(23)14-21(20)22(26)25-13-12-24/h2-7,9-10,16,20-21H,8,11,13-14H2,1H3,(H,25,26)/t16-,20+,21-/m1/s1 |
| InChIKey | SVGXUGNWPUHTTJ-TYCQWZJGSA-N |
| XLogP | 4.94 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|