C23H16F4N2O3S — CID 23648553
[2-(2,3-dimethoxyphenyl)-5-(4-fluorophenyl)-2H-1,3,4-thiadiazol-3-yl]-(2,4,5-trifluorophenyl)methanone (PubChem CID 23648553) has the molecular formula C23H16F4N2O3S and a molecular weight of 476.45 g/mol. Its IUPAC name is [2-(2,3-dimethoxyphenyl)-5-(4-fluorophenyl)-2H-1,3,4-thiadiazol-3-yl]-(2,4,5-trifluorophenyl)methanone.
| Compound Name | [2-(2,3-dimethoxyphenyl)-5-(4-fluorophenyl)-2H-1,3,4-thiadiazol-3-yl]-(2,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 23648553 |
| Molecular Formula | C23H16F4N2O3S |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | [2-(2,3-dimethoxyphenyl)-5-(4-fluorophenyl)-2H-1,3,4-thiadiazol-3-yl]-(2,4,5-trifluorophenyl)methanone |
| SMILES | COc1cccc(C2SC(c3ccc(F)cc3)=NN2C(=O)c2cc(F)c(F)cc2F)c1OC |
| InChI | InChI=1S/C23H16F4N2O3S/c1-31-19-5-3-4-14(20(19)32-2)23-29(22(30)15-10-17(26)18(27)11-16(15)25)28-21(33-23)12-6-8-13(24)9-7-12/h3-11,23H,1-2H3 |
| InChIKey | ROLKOYRAZLSJBT-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|