C23H13ClF3N3O3S — CID 58025899
[2-[5-(4-chlorophenyl)-3-(2,4,6-trifluorobenzoyl)-2H-1,3,4-thiadiazol-2-yl]-6-methoxyphenyl] cyanate (PubChem CID 58025899) has the molecular formula C23H13ClF3N3O3S and a molecular weight of 503.89 g/mol. Its IUPAC name is [2-[5-(4-chlorophenyl)-3-(2,4,6-trifluorobenzoyl)-2H-1,3,4-thiadiazol-2-yl]-6-methoxyphenyl] cyanate.
| Compound Name | [2-[5-(4-chlorophenyl)-3-(2,4,6-trifluorobenzoyl)-2H-1,3,4-thiadiazol-2-yl]-6-methoxyphenyl] cyanate |
|---|---|
| PubChem CID | 58025899 |
| Molecular Formula | C23H13ClF3N3O3S |
| Molecular Weight | 503.89 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | [2-[5-(4-chlorophenyl)-3-(2,4,6-trifluorobenzoyl)-2H-1,3,4-thiadiazol-2-yl]-6-methoxyphenyl] cyanate |
| SMILES | COc1cccc(C2SC(c3ccc(Cl)cc3)=NN2C(=O)c2c(F)cc(F)cc2F)c1OC#N |
| InChI | InChI=1S/C23H13ClF3N3O3S/c1-32-18-4-2-3-15(20(18)33-11-28)23-30(22(31)19-16(26)9-14(25)10-17(19)27)29-21(34-23)12-5-7-13(24)8-6-12/h2-10,23H,1H3 |
| InChIKey | VTACWSSCMFRRKJ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 74.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.89 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|