C16H22F2N2O4 — CID 23648565
[(2R)-1-(benzylamino)-3-(difluoromethoxy)-1-oxopropan-2-yl]-tert-butylcarbamic acid (PubChem CID 23648565) has the molecular formula C16H22F2N2O4 and a molecular weight of 344.36 g/mol. Its IUPAC name is [(2R)-1-(benzylamino)-3-(difluoromethoxy)-1-oxopropan-2-yl]-tert-butylcarbamic acid.
| Compound Name | [(2R)-1-(benzylamino)-3-(difluoromethoxy)-1-oxopropan-2-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 23648565 |
| Molecular Formula | C16H22F2N2O4 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | [(2R)-1-(benzylamino)-3-(difluoromethoxy)-1-oxopropan-2-yl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)[C@H](COC(F)F)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C16H22F2N2O4/c1-16(2,3)20(15(22)23)12(10-24-14(17)18)13(21)19-9-11-7-5-4-6-8-11/h4-8,12,14H,9-10H2,1-3H3,(H,19,21)(H,22,23)/t12-/m1/s1 |
| InChIKey | BWZHBAYEJYLAEG-GFCCVEGCSA-N |
| XLogP | 2.69 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |