C26H31FN2O4 — CID 23650999
3-[[2-[5-[(4-cyclohexyl-2-fluorophenyl)methoxy]-2,3-dihydroindol-1-yl]-2-oxoethyl]amino]propanoic acid (PubChem CID 23650999) has the molecular formula C26H31FN2O4 and a molecular weight of 454.54 g/mol. Its IUPAC name is 3-[[2-[5-[(4-cyclohexyl-2-fluorophenyl)methoxy]-2,3-dihydroindol-1-yl]-2-oxoethyl]amino]propanoic acid.
| Compound Name | 3-[[2-[5-[(4-cyclohexyl-2-fluorophenyl)methoxy]-2,3-dihydroindol-1-yl]-2-oxoethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23650999 |
| Molecular Formula | C26H31FN2O4 |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 3-[[2-[5-[(4-cyclohexyl-2-fluorophenyl)methoxy]-2,3-dihydroindol-1-yl]-2-oxoethyl]amino]propanoic acid |
| SMILES | O=C(O)CCNCC(=O)N1CCc2cc(OCc3ccc(C4CCCCC4)cc3F)ccc21 |
| InChI | InChI=1S/C26H31FN2O4/c27-23-15-19(18-4-2-1-3-5-18)6-7-21(23)17-33-22-8-9-24-20(14-22)11-13-29(24)25(30)16-28-12-10-26(31)32/h6-9,14-15,18,28H,1-5,10-13,16-17H2,(H,31,32) |
| InChIKey | VLSNUPJMKFTCTP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|