C27H30ClF3N2O4 — CID 23650860
3-[[2-[5-[cyclohex-3-en-1-yl-[3-(trifluoromethyl)phenyl]methoxy]-2,3-dihydroindol-1-yl]-2-oxoethyl]amino]propanoic acid;hydrochloride (PubChem CID 23650860) has the molecular formula C27H30ClF3N2O4 and a molecular weight of 538.99 g/mol. Its IUPAC name is 3-[[2-[5-[cyclohex-3-en-1-yl-[3-(trifluoromethyl)phenyl]methoxy]-2,3-dihydroindol-1-yl]-2-oxoethyl]amino]propanoic acid;hydrochloride.
| Compound Name | 3-[[2-[5-[cyclohex-3-en-1-yl-[3-(trifluoromethyl)phenyl]methoxy]-2,3-dihydroindol-1-yl]-2-oxoethyl]amino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 23650860 |
| Molecular Formula | C27H30ClF3N2O4 |
| Molecular Weight | 538.99 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 3-[[2-[5-[cyclohex-3-en-1-yl-[3-(trifluoromethyl)phenyl]methoxy]-2,3-dihydroindol-1-yl]-2-oxoethyl]amino]propanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCNCC(=O)N1CCc2cc(OC(c3cccc(C(F)(F)F)c3)C3CC=CCC3)ccc21 |
| InChI | InChI=1S/C27H29F3N2O4.ClH/c28-27(29,30)21-8-4-7-20(15-21)26(18-5-2-1-3-6-18)36-22-9-10-23-19(16-22)12-14-32(23)24(33)17-31-13-11-25(34)35;/h1-2,4,7-10,15-16,18,26,31H,3,5-6,11-14,17H2,(H,34,35);1H |
| InChIKey | ZXXSWMSZCUUCDR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.99 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|