C26H33N3O4 — CID 89209048
3-[[2-[5-[(3-amino-4-cyclohexylphenyl)methoxy]-2,3-dihydroindol-1-yl]-2-oxoethyl]amino]propanoic acid (PubChem CID 89209048) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is 3-[[2-[5-[(3-amino-4-cyclohexylphenyl)methoxy]-2,3-dihydroindol-1-yl]-2-oxoethyl]amino]propanoic acid.
| Compound Name | 3-[[2-[5-[(3-amino-4-cyclohexylphenyl)methoxy]-2,3-dihydroindol-1-yl]-2-oxoethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 89209048 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 3-[[2-[5-[(3-amino-4-cyclohexylphenyl)methoxy]-2,3-dihydroindol-1-yl]-2-oxoethyl]amino]propanoic acid |
| SMILES | Nc1cc(COc2ccc3c(c2)CCN3C(=O)CNCCC(=O)O)ccc1C1CCCCC1 |
| InChI | InChI=1S/C26H33N3O4/c27-23-14-18(6-8-22(23)19-4-2-1-3-5-19)17-33-21-7-9-24-20(15-21)11-13-29(24)25(30)16-28-12-10-26(31)32/h6-9,14-15,19,28H,1-5,10-13,16-17,27H2,(H,31,32) |
| InChIKey | OGXKXPSULLNCOT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|