C22H20F6N2O4 — CID 42613051
3-[[2-[5-[[3,4-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydroindol-1-yl]-2-oxoethyl]amino]propanoic acid (PubChem CID 42613051) has the molecular formula C22H20F6N2O4 and a molecular weight of 490.40 g/mol. Its IUPAC name is 3-[[2-[5-[[3,4-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydroindol-1-yl]-2-oxoethyl]amino]propanoic acid.
| Compound Name | 3-[[2-[5-[[3,4-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydroindol-1-yl]-2-oxoethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 42613051 |
| Molecular Formula | C22H20F6N2O4 |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 3-[[2-[5-[[3,4-bis(trifluoromethyl)phenyl]methoxy]-2,3-dihydroindol-1-yl]-2-oxoethyl]amino]propanoic acid |
| SMILES | O=C(O)CCNCC(=O)N1CCc2cc(OCc3ccc(C(F)(F)F)c(C(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C22H20F6N2O4/c23-21(24,25)16-3-1-13(9-17(16)22(26,27)28)12-34-15-2-4-18-14(10-15)6-8-30(18)19(31)11-29-7-5-20(32)33/h1-4,9-10,29H,5-8,11-12H2,(H,32,33) |
| InChIKey | ZVNMVANIJTWBOM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|