C14H16O3 — CID 23651021
(8R,8aS)-7-methylspiro[2,3,4,8a-tetrahydronaphthalene-8,3'-oxolane]-1,2'-dione (PubChem CID 23651021) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is (8R,8aS)-7-methylspiro[2,3,4,8a-tetrahydronaphthalene-8,3'-oxolane]-1,2'-dione.
| Compound Name | (8R,8aS)-7-methylspiro[2,3,4,8a-tetrahydronaphthalene-8,3'-oxolane]-1,2'-dione |
|---|---|
| PubChem CID | 23651021 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (8R,8aS)-7-methylspiro[2,3,4,8a-tetrahydronaphthalene-8,3'-oxolane]-1,2'-dione |
| SMILES | CC1=CC=C2CCCC(=O)[C@@H]2[C@]12CCOC2=O |
| InChI | InChI=1S/C14H16O3/c1-9-5-6-10-3-2-4-11(15)12(10)14(9)7-8-17-13(14)16/h5-6,12H,2-4,7-8H2,1H3/t12-,14+/m1/s1 |
| InChIKey | JSHMSSIRDXAJLY-OCCSQVGLSA-N |
| XLogP | 2.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |