C9H15NO2 — CID 97305435
(5R,10R)-10-methyl-2-oxa-9-azaspiro[4.5]decan-1-one (PubChem CID 97305435) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (5R,10R)-10-methyl-2-oxa-9-azaspiro[4.5]decan-1-one.
| Compound Name | (5R,10R)-10-methyl-2-oxa-9-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 97305435 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (5R,10R)-10-methyl-2-oxa-9-azaspiro[4.5]decan-1-one |
| SMILES | C[C@H]1NCCC[C@@]12CCOC2=O |
| InChI | InChI=1S/C9H15NO2/c1-7-9(3-2-5-10-7)4-6-12-8(9)11/h7,10H,2-6H2,1H3/t7-,9-/m1/s1 |
| InChIKey | PHGSHOMLQWBDPR-VXNVDRBHSA-N |
| XLogP | 0.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |