C10H14O4 — CID 24755778
(5R,6R)-6-hydroxy-8-(hydroxymethyl)-2-oxaspiro[4.5]dec-7-en-1-one (PubChem CID 24755778) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (5R,6R)-6-hydroxy-8-(hydroxymethyl)-2-oxaspiro[4.5]dec-7-en-1-one.
| Compound Name | (5R,6R)-6-hydroxy-8-(hydroxymethyl)-2-oxaspiro[4.5]dec-7-en-1-one |
|---|---|
| PubChem CID | 24755778 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (5R,6R)-6-hydroxy-8-(hydroxymethyl)-2-oxaspiro[4.5]dec-7-en-1-one |
| SMILES | O=C1OCC[C@@]12CCC(CO)=C[C@H]2O |
| InChI | InChI=1S/C10H14O4/c11-6-7-1-2-10(8(12)5-7)3-4-14-9(10)13/h5,8,11-12H,1-4,6H2/t8-,10-/m1/s1 |
| InChIKey | UBZLCBSCXZWYIU-PSASIEDQSA-N |
| XLogP | -0.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|