C16H18O6 — CID 23651316
methyl (2Z)-2-[(4S,6S,10R)-6-methyl-8,12-dioxo-5,11-dioxatricyclo[8.2.1.04,6]tridec-1(13)-en-9-ylidene]propanoate (PubChem CID 23651316) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is methyl (2Z)-2-[(4S,6S,10R)-6-methyl-8,12-dioxo-5,11-dioxatricyclo[8.2.1.04,6]tridec-1(13)-en-9-ylidene]propanoate.
| Compound Name | methyl (2Z)-2-[(4S,6S,10R)-6-methyl-8,12-dioxo-5,11-dioxatricyclo[8.2.1.04,6]tridec-1(13)-en-9-ylidene]propanoate |
|---|---|
| PubChem CID | 23651316 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | methyl (2Z)-2-[(4S,6S,10R)-6-methyl-8,12-dioxo-5,11-dioxatricyclo[8.2.1.04,6]tridec-1(13)-en-9-ylidene]propanoate |
| SMILES | COC(=O)/C(C)=C1\C(=O)C[C@]2(C)O[C@H]2CCC2=C[C@H]1OC2=O |
| InChI | InChI=1S/C16H18O6/c1-8(14(18)20-3)13-10(17)7-16(2)12(22-16)5-4-9-6-11(13)21-15(9)19/h6,11-12H,4-5,7H2,1-3H3/b13-8+/t11-,12+,16+/m1/s1 |
| InChIKey | VGSSDIJIZFPPLT-OVFVPGIDSA-N |
| XLogP | 1.24 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|