C22H27N7OS — CID 23652669
1-[4-[4-[[4-[2-(ethylamino)-4-methyl-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanone (PubChem CID 23652669) has the molecular formula C22H27N7OS and a molecular weight of 437.57 g/mol. Its IUPAC name is 1-[4-[4-[[4-[2-(ethylamino)-4-methyl-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-[[4-[2-(ethylamino)-4-methyl-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 23652669 |
| Molecular Formula | C22H27N7OS |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 1-[4-[4-[[4-[2-(ethylamino)-4-methyl-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanone |
| SMILES | CCNc1nc(C)c(-c2ccnc(Nc3ccc(N4CCN(C(C)=O)CC4)cc3)n2)s1 |
| InChI | InChI=1S/C22H27N7OS/c1-4-23-22-25-15(2)20(31-22)19-9-10-24-21(27-19)26-17-5-7-18(8-6-17)29-13-11-28(12-14-29)16(3)30/h5-10H,4,11-14H2,1-3H3,(H,23,25)(H,24,26,27) |
| InChIKey | RPMKNQKYFFKBAZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|