C19H15BrN6O6 — CID 23652944
[2-[(5-bromoquinoxalin-6-yl)amino]-4,5-dihydroimidazol-1-yl]methyl (2-nitrooxyphenyl) carbonate (PubChem CID 23652944) has the molecular formula C19H15BrN6O6 and a molecular weight of 503.27 g/mol. Its IUPAC name is [2-[(5-bromoquinoxalin-6-yl)amino]-4,5-dihydroimidazol-1-yl]methyl (2-nitrooxyphenyl) carbonate.
| Compound Name | [2-[(5-bromoquinoxalin-6-yl)amino]-4,5-dihydroimidazol-1-yl]methyl (2-nitrooxyphenyl) carbonate |
|---|---|
| PubChem CID | 23652944 |
| Molecular Formula | C19H15BrN6O6 |
| Molecular Weight | 503.27 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | [2-[(5-bromoquinoxalin-6-yl)amino]-4,5-dihydroimidazol-1-yl]methyl (2-nitrooxyphenyl) carbonate |
| SMILES | O=C(OCN1CCN=C1Nc1ccc2nccnc2c1Br)Oc1ccccc1O[N+](=O)[O-] |
| InChI | InChI=1S/C19H15BrN6O6/c20-16-12(5-6-13-17(16)22-8-7-21-13)24-18-23-9-10-25(18)11-30-19(27)31-14-3-1-2-4-15(14)32-26(28)29/h1-8H,9-11H2,(H,23,24) |
| InChIKey | ZKQPYQXZDFLEOF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 141.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|