C22H18O6 — CID 23655159
methyl 2-[2-(6-methoxycarbonyl-1-benzofuran-2-yl)ethyl]-1-benzofuran-6-carboxylate (PubChem CID 23655159) has the molecular formula C22H18O6 and a molecular weight of 378.38 g/mol. Its IUPAC name is methyl 2-[2-(6-methoxycarbonyl-1-benzofuran-2-yl)ethyl]-1-benzofuran-6-carboxylate.
| Compound Name | methyl 2-[2-(6-methoxycarbonyl-1-benzofuran-2-yl)ethyl]-1-benzofuran-6-carboxylate |
|---|---|
| PubChem CID | 23655159 |
| Molecular Formula | C22H18O6 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | methyl 2-[2-(6-methoxycarbonyl-1-benzofuran-2-yl)ethyl]-1-benzofuran-6-carboxylate |
| SMILES | COC(=O)c1ccc2cc(CCc3cc4ccc(C(=O)OC)cc4o3)oc2c1 |
| InChI | InChI=1S/C22H18O6/c1-25-21(23)15-5-3-13-9-17(27-19(13)11-15)7-8-18-10-14-4-6-16(22(24)26-2)12-20(14)28-18/h3-6,9-12H,7-8H2,1-2H3 |
| InChIKey | NJKUITIJJBOWGT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |