C16H15Cl2NO2 — CID 23655215
4-chloro-5-(3-chloropropyl)-1-(2-methylphenyl)-6-oxopyridine-3-carbaldehyde (PubChem CID 23655215) has the molecular formula C16H15Cl2NO2 and a molecular weight of 324.21 g/mol. Its IUPAC name is 4-chloro-5-(3-chloropropyl)-1-(2-methylphenyl)-6-oxopyridine-3-carbaldehyde.
| Compound Name | 4-chloro-5-(3-chloropropyl)-1-(2-methylphenyl)-6-oxopyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 23655215 |
| Molecular Formula | C16H15Cl2NO2 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 4-chloro-5-(3-chloropropyl)-1-(2-methylphenyl)-6-oxopyridine-3-carbaldehyde |
| SMILES | Cc1ccccc1-n1cc(C=O)c(Cl)c(CCCCl)c1=O |
| InChI | InChI=1S/C16H15Cl2NO2/c1-11-5-2-3-7-14(11)19-9-12(10-20)15(18)13(16(19)21)6-4-8-17/h2-3,5,7,9-10H,4,6,8H2,1H3 |
| InChIKey | ICZIPKJEKDETFG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|