C18H15FN2O6 — CID 23656774
3-[(2-fluoro-4-nitrophenoxy)methyl]-6-methoxy-1,2-dimethylindole-4,7-dione (PubChem CID 23656774) has the molecular formula C18H15FN2O6 and a molecular weight of 374.32 g/mol. Its IUPAC name is 3-[(2-fluoro-4-nitrophenoxy)methyl]-6-methoxy-1,2-dimethylindole-4,7-dione.
| Compound Name | 3-[(2-fluoro-4-nitrophenoxy)methyl]-6-methoxy-1,2-dimethylindole-4,7-dione |
|---|---|
| PubChem CID | 23656774 |
| Molecular Formula | C18H15FN2O6 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 3-[(2-fluoro-4-nitrophenoxy)methyl]-6-methoxy-1,2-dimethylindole-4,7-dione |
| SMILES | COC1=CC(=O)c2c(COc3ccc([N+](=O)[O-])cc3F)c(C)n(C)c2C1=O |
| InChI | InChI=1S/C18H15FN2O6/c1-9-11(8-27-14-5-4-10(21(24)25)6-12(14)19)16-13(22)7-15(26-3)18(23)17(16)20(9)2/h4-7H,8H2,1-3H3 |
| InChIKey | JMNUSJGFDWUZFR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 100.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|