C18H14FN5O4 — CID 46484663
1-[(2-fluoro-4-nitrophenoxy)methyl]-4,7-dimethyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 46484663) has the molecular formula C18H14FN5O4 and a molecular weight of 383.34 g/mol. Its IUPAC name is 1-[(2-fluoro-4-nitrophenoxy)methyl]-4,7-dimethyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 1-[(2-fluoro-4-nitrophenoxy)methyl]-4,7-dimethyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 46484663 |
| Molecular Formula | C18H14FN5O4 |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 1-[(2-fluoro-4-nitrophenoxy)methyl]-4,7-dimethyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | Cc1ccc2c(c1)c(=O)n(C)c1nnc(COc3ccc([N+](=O)[O-])cc3F)n21 |
| InChI | InChI=1S/C18H14FN5O4/c1-10-3-5-14-12(7-10)17(25)22(2)18-21-20-16(23(14)18)9-28-15-6-4-11(24(26)27)8-13(15)19/h3-8H,9H2,1-2H3 |
| InChIKey | IEPONBDDWZTBSP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|