C19H14ClN5O5 — CID 55731638
(4,7-dimethyl-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)methyl 4-chloro-2-nitrobenzoate (PubChem CID 55731638) has the molecular formula C19H14ClN5O5 and a molecular weight of 427.80 g/mol. Its IUPAC name is (4,7-dimethyl-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)methyl 4-chloro-2-nitrobenzoate.
| Compound Name | (4,7-dimethyl-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)methyl 4-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 55731638 |
| Molecular Formula | C19H14ClN5O5 |
| Molecular Weight | 427.80 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | (4,7-dimethyl-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)methyl 4-chloro-2-nitrobenzoate |
| SMILES | Cc1ccc2c(c1)c(=O)n(C)c1nnc(COC(=O)c3ccc(Cl)cc3[N+](=O)[O-])n21 |
| InChI | InChI=1S/C19H14ClN5O5/c1-10-3-6-14-13(7-10)17(26)23(2)19-22-21-16(24(14)19)9-30-18(27)12-5-4-11(20)8-15(12)25(28)29/h3-8H,9H2,1-2H3 |
| InChIKey | WYSYMXPMBJYTAD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 121.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.80 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|