C16H12N6O5S — CID 55728385
(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)methyl 4-amino-3-nitrobenzoate (PubChem CID 55728385) has the molecular formula C16H12N6O5S and a molecular weight of 400.38 g/mol. Its IUPAC name is (8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)methyl 4-amino-3-nitrobenzoate.
| Compound Name | (8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)methyl 4-amino-3-nitrobenzoate |
|---|---|
| PubChem CID | 55728385 |
| Molecular Formula | C16H12N6O5S |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | (8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)methyl 4-amino-3-nitrobenzoate |
| SMILES | Cn1c(=O)c2sccc2n2c(COC(=O)c3ccc(N)c([N+](=O)[O-])c3)nnc12 |
| InChI | InChI=1S/C16H12N6O5S/c1-20-14(23)13-10(4-5-28-13)21-12(18-19-16(20)21)7-27-15(24)8-2-3-9(17)11(6-8)22(25)26/h2-6H,7,17H2,1H3 |
| InChIKey | GGCIZDRTXSSVKN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 147.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|