C24H19N5O4S — CID 55995730
(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)methyl 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate (PubChem CID 55995730) has the molecular formula C24H19N5O4S and a molecular weight of 473.51 g/mol. Its IUPAC name is (8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)methyl 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate.
| Compound Name | (8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)methyl 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55995730 |
| Molecular Formula | C24H19N5O4S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | (8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)methyl 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate |
| SMILES | Cn1c(=O)c2sccc2n2c(COC(=O)C=Cc3ccc(OCc4ccccn4)cc3)nnc12 |
| InChI | InChI=1S/C24H19N5O4S/c1-28-23(31)22-19(11-13-34-22)29-20(26-27-24(28)29)15-33-21(30)10-7-16-5-8-18(9-6-16)32-14-17-4-2-3-12-25-17/h2-13H,14-15H2,1H3 |
| InChIKey | ZGNVYPWWVXZTJO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 100.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|