C17H12N4O5S — CID 55728353
(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)methyl 1,3-benzodioxole-5-carboxylate (PubChem CID 55728353) has the molecular formula C17H12N4O5S and a molecular weight of 384.37 g/mol. Its IUPAC name is (8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)methyl 1,3-benzodioxole-5-carboxylate.
| Compound Name | (8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)methyl 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 55728353 |
| Molecular Formula | C17H12N4O5S |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | (8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)methyl 1,3-benzodioxole-5-carboxylate |
| SMILES | Cn1c(=O)c2sccc2n2c(COC(=O)c3ccc4c(c3)OCO4)nnc12 |
| InChI | InChI=1S/C17H12N4O5S/c1-20-15(22)14-10(4-5-27-14)21-13(18-19-17(20)21)7-24-16(23)9-2-3-11-12(6-9)26-8-25-11/h2-6H,7-8H2,1H3 |
| InChIKey | SSMSHFLIJJIJQQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 96.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |