C16H17IN2O — CID 23657234
5-iodo-1-[(4-methoxyphenyl)methyl]-3,4-dihydro-2H-1,8-naphthyridine (PubChem CID 23657234) has the molecular formula C16H17IN2O and a molecular weight of 380.23 g/mol. Its IUPAC name is 5-iodo-1-[(4-methoxyphenyl)methyl]-3,4-dihydro-2H-1,8-naphthyridine.
| Compound Name | 5-iodo-1-[(4-methoxyphenyl)methyl]-3,4-dihydro-2H-1,8-naphthyridine |
|---|---|
| PubChem CID | 23657234 |
| Molecular Formula | C16H17IN2O |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 5-iodo-1-[(4-methoxyphenyl)methyl]-3,4-dihydro-2H-1,8-naphthyridine |
| SMILES | COc1ccc(CN2CCCc3c(I)ccnc32)cc1 |
| InChI | InChI=1S/C16H17IN2O/c1-20-13-6-4-12(5-7-13)11-19-10-2-3-14-15(17)8-9-18-16(14)19/h4-9H,2-3,10-11H2,1H3 |
| InChIKey | IRPMLWWEGVXJMN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|