C20H20N4O3 — CID 23658235
(2E,4E)-5-(2-nitrophenyl)-1-(4-pyridin-2-ylpiperazin-1-yl)penta-2,4-dien-1-one (PubChem CID 23658235) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is (2E,4E)-5-(2-nitrophenyl)-1-(4-pyridin-2-ylpiperazin-1-yl)penta-2,4-dien-1-one.
| Compound Name | (2E,4E)-5-(2-nitrophenyl)-1-(4-pyridin-2-ylpiperazin-1-yl)penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 23658235 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (2E,4E)-5-(2-nitrophenyl)-1-(4-pyridin-2-ylpiperazin-1-yl)penta-2,4-dien-1-one |
| SMILES | O=C(/C=C/C=C/c1ccccc1[N+](=O)[O-])N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C20H20N4O3/c25-20(11-4-2-8-17-7-1-3-9-18(17)24(26)27)23-15-13-22(14-16-23)19-10-5-6-12-21-19/h1-12H,13-16H2/b8-2+,11-4+ |
| InChIKey | APHUBFYHUBPJKO-QCNCOMHOSA-N |
| XLogP | 2.91 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|