C19H31IOSi — CID 23658987
tert-butyl-[(3S,5R)-3-(3-iodoprop-2-ynyl)-5-methyl-2-prop-2-enylcyclohexen-1-yl]oxy-dimethylsilane (PubChem CID 23658987) has the molecular formula C19H31IOSi and a molecular weight of 430.45 g/mol. Its IUPAC name is tert-butyl-[(3S,5R)-3-(3-iodoprop-2-ynyl)-5-methyl-2-prop-2-enylcyclohexen-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,5R)-3-(3-iodoprop-2-ynyl)-5-methyl-2-prop-2-enylcyclohexen-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 23658987 |
| Molecular Formula | C19H31IOSi |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | tert-butyl-[(3S,5R)-3-(3-iodoprop-2-ynyl)-5-methyl-2-prop-2-enylcyclohexen-1-yl]oxy-dimethylsilane |
| SMILES | C=CCC1=C(O[Si](C)(C)C(C)(C)C)C[C@H](C)C[C@H]1CC#CI |
| InChI | InChI=1S/C19H31IOSi/c1-8-10-17-16(11-9-12-20)13-15(2)14-18(17)21-22(6,7)19(3,4)5/h8,15-16H,1,10-11,13-14H2,2-7H3/t15-,16-/m1/s1 |
| InChIKey | FSCRCVDXEAXJQU-HZPDHXFCSA-N |
| XLogP | 6.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|